Asked by: Zilda Keshav
asked in category: General Last Updated: 26th February, 2020

What is a common name for fat?

Unsaturated fatty acids
Common name Chemical structure IUPAC
Eicosapentaenoic acid CH3CH2CH=CHCH2CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH2)3COOH 20:5(5,8,11,14,17)
Erucic acid CH3(CH2)7CH=CH(CH2)11COOH 22:1(13)
Docosahexaenoic acid CH3CH2CH=CHCH2CH=CHCH2CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH2)2COOH 22:6(4,7,10,13,16,19)

Click to see full answer.


Likewise, people ask, what are other names for fats?

The kind of fat that is most widespread in our food AND in our body is called Triglycerides. This is made up of a substance called glycerol with up to three fatty acids attached. There are three kind of fatty acids: saturated (SFA), monounsaturated (MUFA) and polyunsaturated (PUFA).

Additionally, what is a healthy fat? Healthy or “good” fats Monounsaturated fats and polyunsaturated fats are known as the “good fats” because they are good for your heart, your cholesterol, and your overall health. These fats can help to: Lower the risk of heart disease and stroke. Lower bad LDL cholesterol levels, while increasing good HDL.

One may also ask, what is an example of a fat?

Fats. Fats in food come in several forms, including saturated, monounsaturated, and polyunsaturated. Too much fat or too much of the wrong type of fat can be unhealthy. Some examples of foods that contain fats are butter, oil, nuts, meat, fish, and some dairy products.

Where does fat come from?

Fat, or adipose tissue, is found in several places in your body. Generally, fat is found underneath your skin (subcutaneous fat). There's also some on top of each of your kidneys. In addition to fat tissue, some fat is stored in the liver, and an even smaller amount in muscle.

38 Related Question Answers Found

How can u tell if ur fat?

What is natural fat?

What does fat food mean?


What do fats do?

Why do we need fat?

What are the sources of fats and oil?


What is the chemical structure of fats?

Is peanut butter a healthy fat?

What are good carbs to eat?


What are good fats?

What foods are high in fat?

Is butter a healthy fat?


Is peanut butter good for you?

What foods are high in protein?